
CAS 117752-78-0
:5-Chloro-2-methyl-1H-indole-3-ethanol
Description:
5-Chloro-2-methyl-1H-indole-3-ethanol is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a chlorine atom at the 5-position and a methyl group at the 2-position of the indole ring contributes to its unique reactivity and properties. The hydroxyl group (-OH) at the 3-position indicates that it is an alcohol, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure suggests potential interactions with various biological targets, and it may be studied for its effects in drug development. Additionally, the presence of halogen and functional groups can influence its stability, reactivity, and potential applications in organic synthesis. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.
Formula:C11H12ClNO
InChI:InChI=1S/C11H12ClNO/c1-7-9(4-5-14)10-6-8(12)2-3-11(10)13-7/h2-3,6,13-14H,4-5H2,1H3
InChI key:InChIKey=BBMMHZNXGQLKQO-UHFFFAOYSA-N
SMILES:C(CO)C=1C=2C(NC1C)=CC=C(Cl)C2
Synonyms:- 2-(5-Chloro-2-methyl-1H-indol-3-yl)ethanol
- 2-(5-Chloro-2-methyl-1H-indol-3-yl)ethan-1-ol
- 1H-Indole-3-ethanol, 5-chloro-2-methyl-
- 2-(5-Chloro-2-methyl-1H-3-indolyl)-1-ethanol
- 5-Chloro-2-methyl-1H-indole-3-ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.