CAS 117755-95-0

2-Methyl-N-(2-methylphenyl)alanine

Description:

2-Methyl-N-(2-methylphenyl)alanine, with the CAS number 117755-95-0, is an amino acid derivative characterized by its unique structure, which includes a methyl group on the alpha carbon and a substituted phenyl group. This compound features a chiral center, leading to the existence of enantiomers, which can exhibit different biological activities. It is typically classified as a non-polar amino acid due to the presence of hydrophobic methyl groups, influencing its solubility and interactions in biological systems. The presence of the aromatic ring contributes to its potential for π-π stacking interactions, which can be significant in protein folding and stability. This compound may be of interest in pharmaceutical research, particularly in the design of peptides or proteins with specific functionalities. Additionally, its structural characteristics may affect its reactivity and interactions with other biomolecules, making it a subject of study in fields such as medicinal chemistry and biochemistry.

Formula: C₁₁H₁₅NO₂

InChI: InChI=1S/C11H15NO2/c1-8-6-4-5-7-9(8)12-11(2,3)10(13)14/h4-7,12H,1-3H3,(H,13,14)

InChI key: InChIKey=BGPKMWAGWPGAQM-UHFFFAOYSA-N

SMILES: N(C(C(O)=O)(C)C)C1=C(C)C=CC=C1

Synonyms:

• 2-Methyl-N-(2-methylphenyl)alanine
• 2-Methyl-2-[(2-methylphenyl)amino]propanoic acid
• Alanine, 2-methyl-N-o-tolyl-
• Alanine, 2-methyl-N-(2-methylphenyl)-