CAS 1177558-46-1

3-Bromo-5-methoxybenzenemethanamine

Description:

3-Bromo-5-methoxybenzenemethanamine, identified by its CAS number 1177558-46-1, is an organic compound that features a benzene ring substituted with both a bromine atom and a methoxy group, along with an amine functional group. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and potential applications in synthesis. The methoxy group, a common substituent in organic chemistry, can enhance the compound's solubility and may also affect its electronic properties. The amine group indicates that the compound can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound may be of interest in medicinal chemistry and materials science due to its potential biological activity and utility in the synthesis of more complex molecules. Its specific characteristics, such as melting point, boiling point, and solubility, would typically be determined through experimental methods and may vary based on purity and environmental conditions.

Formula: C₈H₁₀BrNO

InChI: InChI=1S/C8H10BrNO/c1-11-8-3-6(5-10)2-7(9)4-8/h2-4H,5,10H2,1H3

InChI key: InChIKey=DFTOTOJXAAJQNO-UHFFFAOYSA-N

SMILES: C(N)C1=CC(OC)=CC(Br)=C1

Synonyms:

• 3-Bromo-5-methoxybenzylamine
• Benzenemethanamine, 3-bromo-5-methoxy-
• 3-Bromo-5-methoxybenzenemethanamine
• (3-Bromo-5-methoxyphenyl)methanamine
• [[3-Bromo-5-(methyloxy)phenyl]methyl]amine