CAS 117766-87-7
:5,6,8,9-Tetrahydro-7H-dibenzo[c,g]carbazole
Description:
5,6,8,9-Tetrahydro-7H-dibenzo[c,g]carbazole is an organic compound characterized by its complex polycyclic structure, which consists of fused benzene rings and a carbazole moiety. This compound typically exhibits a high degree of stability due to its aromatic character, and it may display interesting electronic properties, making it of interest in various fields such as organic electronics and materials science. Its molecular structure suggests potential applications in organic semiconductors or as a building block in the synthesis of more complex organic molecules. The presence of multiple fused rings can also influence its solubility and reactivity, which are important factors in its application. Additionally, compounds of this type may exhibit biological activity, warranting investigation into their pharmacological properties. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise information. Overall, 5,6,8,9-Tetrahydro-7H-dibenzo[c,g]carbazole represents a fascinating subject for further research in both synthetic and applied chemistry.
Formula:C20H17N
InChI:InChI=1/C20H17N/c1-3-7-15-13(5-1)9-11-17-19(15)20-16-8-4-2-6-14(16)10-12-18(20)21-17/h1-8,21H,9-12H2
SMILES:c1ccc2c(c1)CCc1c2c2c3ccccc3CCc2[nH]1
Synonyms:- 6,7,8,9-Tetrahydro-5H-dibenzo[c,g]carbazole
- 5,6,8,9-Tetrahydro-7H-dibenzo[c,g]carbazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5,6,8,9-Tetrahydro-7H-dibenzo[c,g]carbazole
CAS:Controlled ProductApplications 5,6,8,9-Tetrahydro-7H-dibenzo[c,g]carbazole (cas# 117766-87-7) is a compound useful in organic synthesis.
Formula:C20H17NColor and Shape:NeatMolecular weight:271.36
