CAS 117776-80-4

Glycine, N-[(3-aminopyrazinyl)carbonyl]-, methyl ester

Description:

Glycine, N-[(3-aminopyrazinyl)carbonyl]-, methyl ester, with the CAS number 117776-80-4, is a chemical compound that features a glycine backbone modified with a pyrazine moiety. This compound is characterized by its amino acid structure, which includes an amine group, a carboxyl group, and a methyl ester functional group. The presence of the 3-aminopyrazinyl group introduces additional nitrogen atoms and aromatic characteristics, which can influence its reactivity and biological activity. Glycine derivatives are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs that target specific biological pathways. The methyl ester form can enhance lipophilicity, potentially improving membrane permeability. This compound may exhibit properties such as solubility in polar solvents and varying stability depending on environmental conditions. Its unique structure allows for interactions with biological systems, making it of interest in medicinal chemistry and biochemistry research.

Formula: C₈H₁₀N₄O₃

InChI: InChI=1S/C8H10N4O3/c1-15-5(13)4-12-8(14)6-7(9)11-3-2-10-6/h2-3H,4H2,1H3,(H2,9,11)(H,12,14)

InChI key: InChIKey=PDEJRXVDOINCET-UHFFFAOYSA-N

SMILES: C(NCC(OC)=O)(=O)C=1C(N)=NC=CN1

Synonyms:

• Glycine, N-[(3-aminopyrazinyl)carbonyl]-, methyl ester