CAS 117782-76-0

Pyrazolo[1,5-a]pyridin-3-ylmethanol

Description:

Pyrazolo[1,5-a]pyridin-3-ylmethanol is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyridine moieties. This compound features a hydroxymethyl group (-CH2OH) attached to the pyridine ring, contributing to its potential reactivity and solubility in various solvents. It is typically a white to off-white solid, and its molecular structure allows for various interactions, making it of interest in medicinal chemistry and drug development. The presence of the hydroxymethyl group can influence its biological activity, potentially enhancing its ability to interact with biological targets. Pyrazolo[1,5-a]pyridin-3-ylmethanol may exhibit properties such as moderate to high polarity, which can affect its pharmacokinetics and bioavailability. Additionally, the compound may participate in hydrogen bonding due to the hydroxyl group, further influencing its chemical behavior and interactions. Overall, this compound is significant in research contexts, particularly in the exploration of new therapeutic agents.

Formula: C₈H₈N₂O

InChI: InChI=1/C8H8N2O/c11-6-7-5-9-10-4-2-1-3-8(7)10/h1-5,11H,6H2

SMILES: c1ccn2c(c1)c(cn2)CO

Synonyms:

• Pyrazolo[1,5-a]pyridine-3-methanol

Pyrazolo[1,5-a]pyridine-3-methanol

CAS: 117782-76-0

Formula: C₈H₈N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 148.1619

Ref: IN-DA0081FG

Pyrazolo[1,5-a]pyridin-3-ylmethanol

CAS: 117782-76-0

Pyrazolo[1,5-a]pyridin-3-ylmethanol

Purity: 97%

Molecular weight: 148.16g/mol

Ref: 54-OR1031453

PYRAZOLO[1,5-A]PYRIDIN-3-YLMETHANOL

CAS: 117782-76-0

Formula: C₈H₈N₂O

Purity: 97%

Molecular weight: 148.165

Ref: 10-F468904

(H-Pyrazolo[1,5-a]pyridin-3-yl)methanol

CAS: 117782-76-0

Pyrazolopyridazine is a compound that has antiparasitic and antibiotic properties. It is used as an antiparasitic drug in the treatment of roundworm, hookworm, whipworm, and tapeworm infections. Pyrazolopyridazine is also used to treat bacterial infections such as tuberculosis. This drug has been shown to be effective against both Gram-positive and Gram-negative bacteria. Pyrazolopyridazine also exhibits antiviral properties against HIV-1 (human immunodeficiency virus) replication in human lymphocytes in vitro. The synthetic pathway of pyrazolopyridazine involves the condensation of 2-aminoacetophenone with 3-chloro-5-(2,4,6-trichlorophenyl)-pyridine followed by reaction with ammonia to give 3-amino-N-(2,4,6-trichlorophenyl)pyrazole.
Pyrazolopyr

Formula: C₈H₈N₂O

Purity: Min. 95%

Molecular weight: 148.16 g/mol

Ref: 3D-SEA78276