CAS 117782-94-2
:(11β,16α,17α)-11-Hydroxy-16,17-[(1-methylethylidene)bis(oxy)]-3-oxoandrosta-1,4-diene-17-carboxylic acid
Description:
The chemical substance known as (11β,16α,17α)-11-Hydroxy-16,17-[(1-methylethylidene)bis(oxy)]-3-oxoandrosta-1,4-diene-17-carboxylic acid, with the CAS number 117782-94-2, is a synthetic steroid derivative. It features a complex structure characterized by multiple functional groups, including hydroxyl (-OH), carbonyl (C=O), and carboxylic acid (-COOH) groups, which contribute to its biological activity. The presence of the androstane backbone indicates its relation to steroid hormones, and the specific stereochemistry at various positions is crucial for its interaction with biological targets. This compound may exhibit anti-inflammatory and immunosuppressive properties, making it of interest in pharmaceutical applications, particularly in the treatment of conditions requiring modulation of the immune response. Its solubility, stability, and reactivity can vary based on the functional groups and the overall molecular structure, influencing its pharmacokinetics and pharmacodynamics. As with many steroid derivatives, careful consideration of its dosage and potential side effects is essential in therapeutic contexts.
Formula:C23H30O6
InChI:InChI=1S/C23H30O6/c1-20(2)28-17-10-15-14-6-5-12-9-13(24)7-8-21(12,3)18(14)16(25)11-22(15,4)23(17,29-20)19(26)27/h7-9,14-18,25H,5-6,10-11H2,1-4H3,(H,26,27)/t14-,15-,16-,17+,18+,21-,22-,23-/m0/s1
InChI key:InChIKey=FRRZIPPXTFWZML-JBAFZSFZSA-N
SMILES:C(O)(=O)[C@]12[C@]3(C)[C@@](C[C@]1(OC(C)(C)O2)[H])([C@]4([C@]([C@@H](O)C3)([C@]5(C)C(CC4)=CC(=O)C=C5)[H])[H])[H]
Synonyms:- Androsta-1,4-diene-17-carboxylic acid, 11-hydroxy-16,17-[(1-methylethylidene)bis(oxy)]-3-oxo-, (11β,16α,17α)-
- (11β,16α,17α)-11-Hydroxy-16,17-[(1-methylethylidene)bis(oxy)]-3-oxoandrosta-1,4-diene-17-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
17-Carboxy Desonide
CAS:Formula:C23H30O6Color and Shape:White To Off-White SolidMolecular weight:402.49Desglycolaldehyde-carboxyl Desonide
CAS:Controlled ProductApplications Desglycolaldehyde-carboxyl Desonide is an oxidative degradation product of desonide (D296940).
References Nguyen, T., et al.: Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, B42, 403 (1988)Formula:C23H30O6Color and Shape:NeatMolecular weight:402.481


