CAS 1178-28-5
:metoserpate
Description:
Metoserpate, with the CAS number 1178-28-5, is a chemical compound that belongs to the class of anticholinergic agents. It is primarily used in the medical field for its therapeutic effects, particularly in the treatment of certain gastrointestinal disorders and as an adjunct in anesthesia. The compound functions by blocking the action of acetylcholine, a neurotransmitter involved in various bodily functions, which can help reduce secretions and motility in the gastrointestinal tract. Metoserpate is typically administered in a controlled dosage, as its pharmacological effects can lead to side effects such as dry mouth, blurred vision, and urinary retention. Its chemical structure features a specific arrangement of atoms that contributes to its biological activity and efficacy. As with many medications, the use of metoserpate should be monitored by healthcare professionals to ensure safety and effectiveness, considering potential interactions with other drugs and individual patient conditions.
Formula:C24H32N2O5
InChI:InChI=1/C24H32N2O5/c1-28-14-5-6-15-16-7-8-26-12-13-9-20(29-2)23(30-3)21(24(27)31-4)17(13)11-19(26)22(16)25-18(15)10-14/h5-6,10,13,17,19-21,23,25H,7-9,11-12H2,1-4H3/t13-,17+,19-,20+,21+,23+/m1/s1
Synonyms:- Methyl 11,17,18-Trimethoxyyohimban-16-Carboxylate
- Methyl (3Beta,16Beta,17Alpha,18Alpha,20Alpha)-11,17,18-Trimethoxyyohimban-16-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Metoserpate
CAS:Metoserpate is a biochemical.Formula:C24H32N2O5Color and Shape:SolidMolecular weight:428.52Metoserpate
CAS:<p>Applications Reserpine (R144600) derivative as a neuroleptic compound. Reserpine and SU 9064 prolonged the duration for the larva development and only SU 9064 had a mortal effect on larvae.<br>References Schafer, E.W., Jr., et al.: Arch. Environ. Contam. Toxicol., 12, 355 (1983),<br></p>Formula:C24H32N2O5Color and Shape:BeigeMolecular weight:428.52Metoserpate
CAS:Metoserpate is a plant-derived lectin andrographis paniculata that has been used in animal health. It is an insoluble, reconstituted powder that is administered by implanting or by oral administration. Metoserpate is used to enhance the immune system in animals with muscle, skin, and oral diseases. The primary mechanism of action of this compound is through its ability to bind to collagen and extracellular matrix molecules, thereby enhancing the immune response. Metoserpate also has anti-inflammatory properties and can prevent the degradation of hyaluronic acid by inhibiting enzymes such as hyaluronidase.Formula:C24H32N2O5Purity:Min. 97 Area-%Color and Shape:PowderMolecular weight:428.52 g/mol


