CAS 117804-11-2
:Cynarasaponin E
Description:
Cynarasaponin E is a saponin compound derived from the artichoke plant, specifically from the species Cynara scolymus. It is characterized by its glycosidic structure, which typically consists of a hydrophobic aglycone portion linked to one or more hydrophilic sugar moieties. This amphiphilic nature allows saponins like Cynarasaponin E to exhibit surfactant properties, enabling them to interact with cell membranes and potentially influence membrane permeability. Cynarasaponin E has garnered interest for its potential health benefits, including antioxidant, anti-inflammatory, and cholesterol-lowering effects. Additionally, it may possess antimicrobial properties, making it a subject of research in pharmacology and nutrition. The compound is often studied for its role in traditional medicine and its potential applications in functional foods and dietary supplements. As with many saponins, its bioactivity can be influenced by factors such as concentration, formulation, and the presence of other compounds. Overall, Cynarasaponin E represents a fascinating area of study within the field of natural products and their therapeutic potential.
Formula:C42H66O15
InChI:InChI=1S/C42H66O15/c1-19-9-14-42(37(53)57-35-31(49)28(46)27(45)22(17-43)54-35)16-15-40(5)21(26(42)20(19)2)7-8-24-38(3)12-11-25(39(4,18-44)23(38)10-13-41(24,40)6)55-36-32(50)29(47)30(48)33(56-36)34(51)52/h7,19-20,22-33,35-36,43-50H,8-18H2,1-6H3,(H,51,52)/t19-,20+,22-,23-,24-,25+,26+,27-,28+,29+,30+,31-,32-,33+,35+,36-,38+,39+,40-,41-,42+/m1/s1
InChI key:InChIKey=UHQNVKKALWJDQL-MAGWOZCJSA-N
SMILES:C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)(=O)[C@]23[C@](C=4[C@@](C)(CC2)[C@@]5(C)[C@](CC4)([C@]6(C)[C@@](CC5)([C@@](CO)(C)[C@@H](O[C@@H]7O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]7O)CC6)[H])[H])([C@@H](C)[C@H](C)CC3)[H]
Synonyms:- β-D-Glucopyranosiduronic acid, (3β,4α)-28-(β-D-glucopyranosyloxy)-23-hydroxy-28-oxours-12-en-3-yl
- (3β,4α)-28-(β-D-Glucopyranosyloxy)-23-hydroxy-28-oxours-12-en-3-yl β-D-glucopyranosiduronic acid
- Cynarasaponin E
- CynarasaponinE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cynarasaponin E
CAS:Cynarasaponin E is a useful organic compound for research related to life sciences. The catalog number is T126276 and the CAS number is 117804-11-2.Formula:C42H66O15Color and Shape:SolidMolecular weight:810.975
