CAS 117811-20-8: 8-Chloro-11-(4-piperidinylidene)-11H-benzo[5,6]cyclohepta[1,2-b]pyridine
Description:8-Chloro-11-(4-piperidinylidene)-11H-benzo[5,6]cyclohepta[1,2-b]pyridine, with CAS number 117811-20-8, is a chemical compound characterized by its complex bicyclic structure, which includes a benzo[5,6]cyclohepta framework fused with a pyridine ring. The presence of a chloro substituent at the 8-position and a piperidinylidene group at the 11-position contributes to its unique reactivity and potential biological activity. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its structural features suggest potential interactions with biological macromolecules, making it a candidate for further investigation in drug discovery. Additionally, the presence of nitrogen atoms in the piperidine and pyridine rings may influence its solubility and pharmacokinetic properties. Overall, 8-Chloro-11-(4-piperidinylidene)-11H-benzo[5,6]cyclohepta[1,2-b]pyridine represents a class of compounds that could be of interest in both synthetic and medicinal chemistry contexts.
Formula:C19H17ClN2
InChI:InChI=1S/C19H17ClN2/c20-16-5-6-17-15(12-16)4-3-14-2-1-9-22-19(14)18(17)13-7-10-21-11-8-13/h1-6,9,12,21H,7-8,10-11H2
InChI key:InChIKey=DSDQPELJDBELOW-UHFFFAOYSA-N
SMILES:ClC=1C=CC2=C(C=CC=3C=CC=NC3C2=C4CCNCC4)C1
- Synonyms:
- 11H-Benzo[5,6]cyclohepta[1,2-b]pyridine, 8-chloro-11-(4-piperidinylidene)-
- 8-Chloro-11-(4-piperidinylidene)-11H-benzo[5,6]cyclohepta[1,2-b]pyridine

Dehydro Desloratadine (8-chloro-11-(piperidin-4-ylidene)-11H-benzo[5,6]cyclohepta[1,2-b]pyridine)
Ref: 45-1A01110
25mg | 2,647.00 € |

Dehydro Desloratadine
Ref: IN-DA008VWL
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
2.5mg | 628.00 € |

Dehydro Desloratadine
Ref: 4Z-L-1036
5mg | 745.00 € | ||
10mg | 1,165.00 € | ||
25mg | 2,072.00 € | ||
50mg | 3,237.00 € | ||
100mg | 5,178.00 € |

8-Chloro-11-(piperidin-4-ylidene)-11H-benzo[5,6]cyclohepta[1,2-b]pyridine
Controlled ProductRef: TR-C377590
25mg | 2,276.00 € | ||
2500µg | 350.00 € |

13-Chloro-2-(piperidin-4-ylidene)-4-azatricyclo[9.4.0.0,3,8]pentadeca-1(15),3,5,7,9,11,13-heptaene
Ref: 3D-SEA81120
2mg | 664.00 € | ||
5mg | 1,072.00 € | ||
10mg | 1,786.00 € | ||
25mg | 3,332.00 € |