CymitQuimica logo

CAS 117821-07-5

:

(2S,3S,4S,5S)-2-(hydroxymethyl)piperidine-3,4,5-triol

Description:
The chemical substance known as (2S,3S,4S,5S)-2-(hydroxymethyl)piperidine-3,4,5-triol, with the CAS number 117821-07-5, is a piperidine derivative characterized by the presence of multiple hydroxyl groups and a hydroxymethyl substituent. This compound features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, and is specifically configured with stereocenters at the 2, 3, 4, and 5 positions, indicating its chiral nature. The presence of three hydroxyl (-OH) groups contributes to its hydrophilicity, enhancing its solubility in polar solvents, and may influence its reactivity and biological activity. The stereochemistry of the molecule suggests potential interactions with biological systems, making it of interest in medicinal chemistry and drug design. Additionally, the compound's structural features may allow it to participate in hydrogen bonding, which can affect its physical properties, such as melting point and boiling point, as well as its behavior in various chemical reactions. Overall, this compound exemplifies the complexity and diversity of organic molecules in the realm of chemistry.
Formula:C6H13NO4
InChI:InChI=1/C6H13NO4/c8-2-3-5(10)6(11)4(9)1-7-3/h3-11H,1-2H2/t3-,4-,5-,6-/m0/s1
Synonyms:
  • 3,4,5-piperidinetriol, 2-(hydroxymethyl)-, (2S,3S,4S,5S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.