CAS 117823-31-1
:(2Z)-2,4,4-trichloro-3-formylbut-2-enoic acid
Description:
(2Z)-2,4,4-Trichloro-3-formylbut-2-enoic acid is a chemical compound characterized by its unique structure, which includes a conjugated system featuring both a double bond and a carbonyl group. This compound contains three chlorine atoms, which significantly influence its reactivity and properties. The presence of the formyl group (-CHO) indicates that it can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The trichloro substituents enhance its electrophilicity, making it a potential candidate for further chemical transformations. Additionally, the acid functional group (-COOH) suggests that it can exhibit acidic behavior, allowing it to participate in acid-base reactions. The compound's geometric configuration, denoted by the (2Z) designation, indicates the specific spatial arrangement of its substituents, which can affect its physical properties, such as solubility and boiling point. Overall, (2Z)-2,4,4-trichloro-3-formylbut-2-enoic acid is a versatile compound with potential applications in organic synthesis and materials science.
Formula:C5H3Cl3O3
InChI:InChI=1/C5H3Cl3O3/c6-3(5(10)11)2(1-9)4(7)8/h1,4H,(H,10,11)/b3-2-
SMILES:C(=O)/C(=C(\C(=O)O)/Cl)/C(Cl)Cl
Synonyms:- 2-butenoic acid, 2,4,4-trichloro-3-formyl-, (2Z)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Mutagen X
CAS:Mutagen X is an anticancer drug that works by inhibiting kinases, which are enzymes involved in cell cycle regulation and apoptosis. It has been shown to be effective against a variety of human cancer cells, including those from Chinese hamsters. Mutagen X is a potent inhibitor of protein kinases, which play a key role in the growth and proliferation of cancer cells. It has been found to have a high level of potency against tumor cells and can be used as a medicinal drug for cancer treatment. Mutagen X also acts as an inhibitor in urine and has been shown to be effective against various inhibitors.Formula:C5H3Cl3O3Purity:Min. 95%Molecular weight:217.43 g/mol

