CymitQuimica logo

CAS 117825-87-3

:

1-(4-chlorophenyl)-3-(p-tolyl)propan-1-one

Description:
1-(4-chlorophenyl)-3-(p-tolyl)propan-1-one, also known as a substituted ketone, is characterized by its structural features, which include a propanone backbone with a 4-chlorophenyl group and a p-tolyl group attached to the alpha and beta positions, respectively. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic aromatic groups. The presence of the chlorophenyl and tolyl substituents contributes to its potential biological activity, making it of interest in medicinal chemistry and research. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and reductions. Additionally, the compound's properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other chemical species. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C16H15ClO
InChI:InChI=1/C16H15ClO/c1-12-2-4-13(5-3-12)6-11-16(18)14-7-9-15(17)10-8-14/h2-5,7-10H,6,11H2,1H3
SMILES:Cc1ccc(cc1)CCC(=O)c1ccc(cc1)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.