
CAS 1178265-22-9
:1,2,3,4-Tetrahydro-1-methyl-5-quinolinecarboxylic acid
Description:
1,2,3,4-Tetrahydro-1-methyl-5-quinolinecarboxylic acid is a chemical compound characterized by its bicyclic structure, which includes a quinoline moiety. This compound features a tetrahydroquinoline framework, indicating that it has undergone partial hydrogenation, resulting in a saturated ring system. The presence of a carboxylic acid functional group contributes to its acidity and potential reactivity, making it a candidate for various chemical reactions, including esterification and amidation. The methyl group attached to the nitrogen atom of the quinoline ring influences its solubility and biological activity. This compound may exhibit pharmacological properties, as many quinoline derivatives are known for their therapeutic potential. Its specific applications and interactions would depend on further studies, including its behavior in biological systems and its synthesis pathways. Overall, 1,2,3,4-Tetrahydro-1-methyl-5-quinolinecarboxylic acid represents a unique structure within the realm of organic chemistry, with implications for medicinal chemistry and material science.
Formula:C11H13NO2
InChI:InChI=1S/C11H13NO2/c1-12-7-3-5-8-9(11(13)14)4-2-6-10(8)12/h2,4,6H,3,5,7H2,1H3,(H,13,14)
InChI key:InChIKey=YVGNRHRSKQPYIY-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(N(C)CCC2)=CC=C1
Synonyms:- 1,2,3,4-Tetrahydro-1-methyl-5-quinolinecarboxylic acid
- 5-Quinolinecarboxylic acid, 1,2,3,4-tetrahydro-1-methyl-
- 1-Methyl-1,2,3,4-tetrahydro-quinoline-5-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.