
CAS 117832-10-7
:2,4-Diiodo-5-methylbenzenamine
Description:
2,4-Diiodo-5-methylbenzenamine, with the CAS number 117832-10-7, is an organic compound characterized by the presence of two iodine atoms and an amino group attached to a methyl-substituted benzene ring. This compound features a benzene core with a methyl group at the 5-position and iodine substituents at the 2 and 4 positions, which significantly influence its chemical properties and reactivity. The amino group (-NH2) contributes to its basicity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions, including nucleophilic substitutions. The presence of iodine atoms enhances the compound's electron-withdrawing characteristics, which can affect its reactivity in electrophilic aromatic substitution reactions. Additionally, the compound may exhibit interesting biological activities due to its structural features, making it of interest in medicinal chemistry and materials science. Its solubility and stability in different solvents can vary, depending on the specific conditions and the presence of other functional groups.
Formula:C7H7I2N
InChI:InChI=1S/C7H7I2N/c1-4-2-7(10)6(9)3-5(4)8/h2-3H,10H2,1H3
InChI key:InChIKey=GVHUSDOTSIVVCD-UHFFFAOYSA-N
SMILES:CC1=C(I)C=C(I)C(N)=C1
Synonyms:- Benzenamine, 2,4-diiodo-5-methyl-
- 2,4-Diiodo-5-methylbenzenamine
- 2,4-Diiodo-5-methyl-aniline
- 2,4-Diiodo-5-methylaniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
