CAS 117832-11-8

4-Iodo-2,3-dimethylbenzenamine

Description:

4-Iodo-2,3-dimethylbenzenamine, with the CAS number 117832-11-8, is an organic compound characterized by the presence of an amino group (-NH2) attached to a benzene ring that is further substituted with iodine and two methyl groups. This compound belongs to the class of aromatic amines and is notable for its potential applications in organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. The iodine substituent introduces unique reactivity, making it useful in various coupling reactions. The methyl groups contribute to the compound's hydrophobic character and influence its solubility in organic solvents. Additionally, the presence of the amino group can participate in hydrogen bonding, affecting its physical properties such as boiling and melting points. Safety considerations are important, as many aromatic amines can be toxic or carcinogenic, necessitating careful handling and disposal. Overall, 4-Iodo-2,3-dimethylbenzenamine is a compound of interest in both academic research and industrial applications due to its versatile reactivity and structural features.

Formula: C₈H₁₀IN

InChI: InChI=1S/C8H10IN/c1-5-6(2)8(10)4-3-7(5)9/h3-4H,10H2,1-2H3

InChI key: InChIKey=ZHZXYCMLUZIDEB-UHFFFAOYSA-N

SMILES: CC1=C(C)C(N)=CC=C1I

Synonyms:

• 4-Iodo-2,3-dimethylbenzenamine
• Benzenamine, 4-iodo-2,3-dimethyl-