CAS 117832-13-0
:2,5-DIMETHYL-4-IODOANILINE
Description:
2,5-Dimethyl-4-iodoaniline is an organic compound characterized by its aromatic amine structure, which includes a benzene ring substituted with two methyl groups and one iodine atom. The presence of the amino group (-NH2) makes it a derivative of aniline, contributing to its reactivity and potential applications in various chemical reactions, including dye synthesis and as an intermediate in organic synthesis. The iodine substituent enhances the compound's electrophilic properties, making it useful in electrophilic aromatic substitution reactions. Additionally, the methyl groups provide steric hindrance, influencing the compound's reactivity and solubility in different solvents. This compound is typically solid at room temperature and may exhibit moderate to low solubility in water, while being more soluble in organic solvents. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2,5-dimethyl-4-iodoaniline is a valuable compound in synthetic organic chemistry with specific characteristics that dictate its use and handling.
Formula:C8H10IN
InChI:InChI=1/C8H10IN/c1-5-4-8(10)6(2)3-7(5)9/h3-4H,10H2,1-2H3
SMILES:Cc1cc(c(C)cc1I)N
Synonyms:- Chembrdg-Bb 9071881
- Asischem Y88810
- 4-Iodo-2,5-Dimethylaniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.