
CAS 117835-09-3
:5-Methyl-2,4-pyrrolidinedicarboxylic acid
Description:
5-Methyl-2,4-pyrrolidinedicarboxylic acid is a cyclic amino acid derivative characterized by its pyrrolidine ring structure, which contains two carboxylic acid functional groups at the 2 and 4 positions, along with a methyl group at the 5 position. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid groups. It exhibits properties typical of dicarboxylic acids, such as the ability to form salts and esters. The presence of the methyl group can influence its reactivity and steric properties, potentially affecting its interactions in biological systems. This compound may be of interest in various fields, including pharmaceuticals and organic synthesis, due to its potential as a building block for more complex molecules. Additionally, its structural features may confer specific biological activities, making it a candidate for further research in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H11NO4
InChI:InChI=1S/C7H11NO4/c1-3-4(6(9)10)2-5(8-3)7(11)12/h3-5,8H,2H2,1H3,(H,9,10)(H,11,12)
InChI key:InChIKey=KJZYKYAHXKISMI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CC(C(O)=O)C(C)N1
Synonyms:- 2,4-Pyrrolidinedicarboxylic acid, 5-methyl-
- 5-Methyl-2,4-pyrrolidinedicarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
