CAS 117836-27-8
:2-Methyl 1-(phenylmethyl) (2S,5R)-5-hydroxy-1,2-piperidinedicarboxylate
Description:
2-Methyl 1-(phenylmethyl) (2S,5R)-5-hydroxy-1,2-piperidinedicarboxylate is a chemical compound characterized by its piperidine structure, which includes a hydroxyl group and two carboxylate functionalities. The presence of the methyl and phenylmethyl substituents contributes to its unique properties, influencing its solubility and reactivity. This compound is typically a white to off-white solid, and its stereochemistry is significant, as the (2S,5R) configuration can affect its biological activity and interactions. It is often studied in the context of medicinal chemistry due to its potential pharmacological applications. The compound's molecular interactions may involve hydrogen bonding due to the hydroxyl group, and it may participate in various chemical reactions typical of carboxylic acids and esters. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use in laboratory or industrial settings.
Formula:C15H19NO5
InChI:InChI=1S/C15H19NO5/c1-20-14(18)13-8-7-12(17)9-16(13)15(19)21-10-11-5-3-2-4-6-11/h2-6,12-13,17H,7-10H2,1H3/t12-,13+/m1/s1
InChI key:InChIKey=NLHXFVLVIIBQOM-OLZOCXBDSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2[C@H](C(OC)=O)CC[C@@H](O)C2
Synonyms:- 1,2-Piperidinedicarboxylic acid, 5-hydroxy-, 2-methyl 1-(phenylmethyl) ester, (2S-trans)-
- 2-Methyl 1-(phenylmethyl) (2S,5R)-5-hydroxy-1,2-piperidinedicarboxylate
- 1,2-Piperidinedicarboxylic acid, 5-hydroxy-, 2-methyl 1-(phenylmethyl) ester, (2S,5R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.