CAS 117842-09-8

6-methoxy-2-oxo-2H-chromen-7-yl 6-O-[3,4-dihydroxy-4-(hydroxymethyl)tetrahydrofuran-2-yl]hexopyranoside

Description:

6-Methoxy-2-oxo-2H-chromen-7-yl 6-O-[3,4-dihydroxy-4-(hydroxymethyl)tetrahydrofuran-2-yl]hexopyranoside, with CAS number 117842-09-8, is a complex glycoside characterized by its chromone and sugar moieties. The chromone structure contributes to its potential biological activities, including antioxidant and anti-inflammatory properties. The presence of the methoxy and hydroxymethyl groups enhances its solubility and reactivity, which may influence its interaction with biological targets. The tetrahydrofuran ring and hexopyranoside unit suggest that this compound may exhibit unique pharmacological properties, potentially acting as a natural product with therapeutic applications. Its structural complexity indicates that it may participate in various biochemical pathways, making it of interest in medicinal chemistry and natural product research. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations for its application in biological systems. Overall, this compound represents a fascinating area of study for researchers exploring the intersection of chemistry and pharmacology.

Formula: C₂₁H₂₆O₁₃

InChI: InChI=1/C21H26O13/c1-29-11-4-9-2-3-14(23)32-10(9)5-12(11)33-19-17(26)16(25)15(24)13(34-19)6-30-20-18(27)21(28,7-22)8-31-20/h2-5,13,15-20,22,24-28H,6-8H2,1H3

SMILES: COc1cc2ccc(=O)oc2cc1OC1C(C(C(C(COC2C(C(CO)(CO2)O)O)O1)O)O)O

Xeroboside

CAS: 117842-09-8

Formula: C₂₁H₂₆O₁₃

Molecular weight: 486.43

Ref: 4Z-U-014006

Hymexelsin

CAS: 117842-09-8

Hymexelsin is an advanced biopesticide, which is derived from naturally occurring compounds sourced from plant extracts. It operates through a novel mechanism that disrupts specific biochemical pathways essential for pest survival and reproduction. By targeting these pathways, Hymexelsin interferes with critical physiological processes, leading to the effective control of a broad spectrum of agricultural pests.

Formula: C₂₁H₂₆O₁₃

Purity: Min. 95%

Molecular weight: 486.4 g/mol

Ref: 3D-SEA84209