CymitQuimica logo

CAS 117846-57-8

:

2,3-Dibromo-4,5-dimethylpyridine

Description:
2,3-Dibromo-4,5-dimethylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two bromine atoms and two methyl groups. The presence of bromine atoms introduces significant polarity and reactivity, making this compound useful in various chemical reactions, including electrophilic substitution. The methyl groups contribute to the compound's hydrophobic character and can influence its solubility in organic solvents. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. Its molecular structure allows for potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Additionally, the presence of multiple substituents can affect its electronic properties, making it a subject of interest in studies related to reactivity and stability. Safety precautions should be observed when handling this compound due to the toxicity associated with brominated compounds. Overall, 2,3-Dibromo-4,5-dimethylpyridine is a versatile compound with significant implications in chemical research and industry.
Formula:C7H7Br2N
InChI:InChI=1S/C7H7Br2N/c1-4-3-10-7(9)6(8)5(4)2/h3H,1-2H3
InChI key:InChIKey=XEIMZSZZLPUJPT-UHFFFAOYSA-N
SMILES:BrC=1C(C)=C(C)C=NC1Br
Synonyms:
  • 2,3-Dibromo-4,5-dimethylpyridine
  • Pyridine, 2,3-dibromo-4,5-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.