CymitQuimica logo

CAS 117846-66-9

:

4-(4-Formylphenoxy)butyric acid methyl ester

Description:
4-(4-Formylphenoxy)butyric acid methyl ester, with the CAS number 117846-66-9, is an organic compound characterized by its ester functional group and a phenyl ring substituted with a formyl group. This compound typically exhibits a moderate polarity due to the presence of both hydrophobic (aromatic) and hydrophilic (carboxylic acid and ester) components. It is likely to be soluble in organic solvents while having limited solubility in water. The presence of the formyl group suggests potential reactivity, particularly in condensation reactions, making it a useful intermediate in organic synthesis. Additionally, the butyric acid moiety contributes to its potential biological activity, which may be of interest in pharmaceutical applications. The compound's structure allows for various functionalization possibilities, enhancing its utility in chemical research and development. Overall, 4-(4-Formylphenoxy)butyric acid methyl ester is a versatile compound with applications in synthetic organic chemistry and potentially in medicinal chemistry.
Formula:C12H14O4
InChI:InChI=1S/C12H14O4/c1-15-12(14)3-2-8-16-11-6-4-10(9-13)5-7-11/h4-7,9H,2-3,8H2,1H3
InChI key:InChIKey=PZKQCTYDJBHHNB-UHFFFAOYSA-N
SMILES:O(CCCC(OC)=O)C1=CC=C(C=O)C=C1
Synonyms:
  • Butanoic acid, 4-(4-formylphenoxy)-, methyl ester
  • 4-(4-Formylphenoxy)butyric acid methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.