CAS 117847-23-1
:BIS-(4-NITROPHENYL)-2-NITROPHENYLAMINE
Description:
BIS-(4-NITROPHENYL)-2-NITROPHENYLAMINE, with the CAS number 117847-23-1, is an organic compound characterized by its complex molecular structure, which includes multiple nitro groups and an amine functional group. This substance typically appears as a solid, often exhibiting a yellow to orange color due to the presence of nitro groups, which are known to impart chromophoric properties. It is primarily used in the field of organic chemistry and materials science, particularly in the synthesis of dyes and pigments. The presence of nitro groups contributes to its electron-withdrawing characteristics, influencing its reactivity and stability. Additionally, this compound may exhibit properties such as thermal stability and potential applications in electronic materials or as a dye intermediate. Safety considerations are important when handling this compound, as nitro compounds can be hazardous and may pose environmental risks. Proper storage and handling protocols should be followed to mitigate any potential health or safety hazards associated with its use.
Formula:C18H12N4O6
InChI:InChI=1/C18H12N4O6/c23-20(24)15-9-5-13(6-10-15)19(14-7-11-16(12-8-14)21(25)26)17-3-1-2-4-18(17)22(27)28/h1-12H
SMILES:c1ccc(c(c1)N(c1ccc(cc1)N(=O)=O)c1ccc(cc1)N(=O)=O)N(=O)=O
Synonyms:- 4-nitro-N-(2-nitrophenyl)-N-(4-nitrophenyl)aniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzenamine, 2-nitro-N,N-bis(4-nitrophenyl)-
CAS:Formula:C18H12N4O6Color and Shape:SolidMolecular weight:380.3111
