CymitQuimica logo

CAS 1178500-33-8

:

N-(2,2-Difluoroethyl)-4-fluorobenzenamine

Description:
N-(2,2-Difluoroethyl)-4-fluorobenzenamine is an organic compound characterized by its unique structure, which includes a fluorinated ethyl group and an aniline moiety. The presence of multiple fluorine atoms contributes to its chemical stability and influences its reactivity, making it of interest in various applications, including pharmaceuticals and agrochemicals. The compound typically exhibits a moderate to high polarity due to the electronegative fluorine atoms, which can affect its solubility in different solvents. Additionally, the fluorinated groups can enhance the lipophilicity of the molecule, potentially impacting its biological activity and interaction with biological systems. The compound's molecular structure allows for potential hydrogen bonding due to the amine group, which can further influence its physical and chemical properties. Overall, N-(2,2-Difluoroethyl)-4-fluorobenzenamine is a fluorinated aromatic amine that may exhibit unique characteristics relevant to its use in synthetic chemistry and material science.
Formula:C8H8F3N
InChI:InChI=1S/C8H8F3N/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4,8,12H,5H2
InChI key:InChIKey=UVMQQUKVORNOLY-UHFFFAOYSA-N
SMILES:N(CC(F)F)C1=CC=C(F)C=C1
Synonyms:
  • N-(2,2-Difluoroethyl)-4-fluorobenzenamine
  • Benzenamine, N-(2,2-difluoroethyl)-4-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.