CymitQuimica logo

CAS 1178564-27-6

:

4-Chloro-6,7-dihydro-7-(methylsulfonyl)-2-(4-morpholinyl)-5H-pyrrolo[2,3-d]pyrimidine

Description:
4-Chloro-6,7-dihydro-7-(methylsulfonyl)-2-(4-morpholinyl)-5H-pyrrolo[2,3-d]pyrimidine is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a pyrrolo[2,3-d]pyrimidine core. This compound features a chloro substituent at the 4-position and a methylsulfonyl group at the 7-position, contributing to its unique chemical properties. The presence of a morpholine ring enhances its potential for biological activity, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate to high solubility in polar solvents due to the sulfonyl and morpholine functionalities. Its molecular structure suggests potential interactions with biological targets, which may include enzymes or receptors, making it a candidate for pharmaceutical applications. Additionally, the presence of chlorine may influence its reactivity and stability. As with many heterocyclic compounds, it may exhibit specific pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, which are critical for its development as a therapeutic agent.
Formula:C11H15ClN4O3S
InChI:InChI=1S/C11H15ClN4O3S/c1-20(17,18)16-3-2-8-9(12)13-11(14-10(8)16)15-4-6-19-7-5-15/h2-7H2,1H3
InChI key:InChIKey=YCIXFNRCKBRWSA-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)N1C=2C(=C(Cl)N=C(N2)N3CCOCC3)CC1
Synonyms:
  • 4-Chloro-6,7-dihydro-7-(methylsulfonyl)-2-(4-morpholinyl)-5H-pyrrolo[2,3-d]pyrimidine
  • 5H-Pyrrolo[2,3-d]pyrimidine, 4-chloro-6,7-dihydro-7-(methylsulfonyl)-2-(4-morpholinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.