CAS 117858-54-5
:PAM3-CYS-ALA-GLY-OH
Description:
PAM3-CYS-ALA-GLY-OH, with the CAS number 117858-54-5, is a synthetic lipopeptide that serves as a potent immunostimulatory agent. It is characterized by its structural components, which include a palmitic acid moiety (PAM3) linked to a cysteine (CYS), followed by an alanine (ALA) and glycine (GLY) residue, concluding with a hydroxyl group (OH). This compound is known for its ability to mimic bacterial lipoproteins, thereby activating Toll-like receptor 2 (TLR2) pathways, which play a crucial role in the innate immune response. PAM3-CYS-ALA-GLY-OH is often utilized in research to study immune responses, vaccine development, and adjuvant properties. Its amphiphilic nature allows it to interact effectively with cell membranes, enhancing its bioactivity. Additionally, it is soluble in aqueous solutions, making it suitable for various biological assays. Overall, PAM3-CYS-ALA-GLY-OH is a valuable tool in immunology and biochemistry for understanding immune mechanisms and developing therapeutic strategies.
Formula:C59H111N3O9S
InChI:InChI=1/C59H111N3O9S/c1-5-8-11-14-17-20-23-26-29-32-35-38-41-44-54(63)62-53(59(69)61-51(4)58(68)60-47-55(64)65)50-72-49-52(71-57(67)46-43-40-37-34-31-28-25-22-19-16-13-10-7-3)48-70-56(66)45-42-39-36-33-30-27-24-21-18-15-12-9-6-2/h51-53H,5-50H2,1-4H3,(H,60,68)(H,61,69)(H,62,63)(H,64,65)/t51-,52?,53-/m0/s1
SMILES:CCCCCCCCCCCCCCCC(=N[C@@H](CSCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)C(=N[C@@H](C)C(=NCC(=O)O)O)O)O
Synonyms:- S-[2,3-Bis(Palmitoyloxy)-(2Rs)-Propyl]-N-Palmitoyl-(R)-Cys-Ala-Gly-Oh
- Palmitoyl-Cys((Rs)-2,3-Di(Palmitoyloxy)-Propyl)-Ala-Gly-Oh
- N-palmitoyl-5,6-dipalmitoylcysteinyl-alanyl-glycine
- S-[2,3-bis(hexadecanoyloxy)propyl]-N-hexadecanoyl-L-cysteinyl-L-alanylglycine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Palmitoyl-Cys((RS)-2,3-di(palmitoyloxy)-propyl)-Ala-Gly-OH
CAS:Palmitoyl-Cys((RS)-2,3-di(palmitoyloxy)-propyl)-Ala-Gly-OH is a molecule that can be used to generate an antigen against tumor necrosis factor alpha (TNFα). It has been shown to be able to bind TNFα and prevent it from binding to its receptors. This leads to a decrease in the production of cytokines, as well as a decrease in the activation of cytosolic guanylate cyclase. Palmitoyl-Cys((RS)-2,3-di(palmitoyloxy)-propyl)-Ala-Gly-OH has also been shown to inhibit the proliferation of cancer cells by inhibiting extracellular Ca2+ influx and cytosolic Ca2+ ion concentrations.Formula:C59H111N3O9SPurity:Min. 95%Molecular weight:1,038.59 g/molPalmitoyl-Cys((RS)-2,3-di(palmitoyloxy)-propyl)-Ala-Gly-OH
CAS:The synthetic lipopeptide analog Pam3Cys-Ala-Gly, which corresponds to the N-terminal region of a bacterial lipoprotein, is a potent activator of macrophages. It is suggested that the uptake of Pam3CAG into macrophages involves the aggregation of membrane proteins.
Formula:C59H111N3O9SPurity:98%Molecular weight:1038.61

