CAS 117860-34-1
:6-(dimethylamino)-9-(4-methylbenzyl)-2-(trifluoromethyl)-9H-purine
Description:
6-(Dimethylamino)-9-(4-methylbenzyl)-2-(trifluoromethyl)-9H-purine, with CAS number 117860-34-1, is a synthetic organic compound that belongs to the purine class of molecules. This compound features a purine core, which is characterized by a fused double-ring structure containing nitrogen atoms. The presence of a dimethylamino group at the 6-position enhances its basicity and potential for interaction with biological targets, while the 4-methylbenzyl substituent at the 9-position may influence its lipophilicity and binding properties. The trifluoromethyl group at the 2-position contributes to the compound's electronic properties, potentially enhancing its stability and reactivity. Overall, this compound may exhibit interesting pharmacological activities, making it a subject of interest in medicinal chemistry and drug development. Its unique structural features suggest potential applications in various fields, including biochemistry and pharmaceuticals, although specific biological activities would require further investigation through experimental studies.
Formula:C16H16F3N5
InChI:InChI=1/C16H16F3N5/c1-10-4-6-11(7-5-10)8-24-9-20-12-13(23(2)3)21-15(16(17,18)19)22-14(12)24/h4-7,9H,8H2,1-3H3
SMILES:Cc1ccc(cc1)Cn1cnc2c(nc(C(F)(F)F)nc12)N(C)C
Synonyms:- 6-Dmpt
- 9H-purine, 6-(dimethylamino)-9-(4-methylbenzyl)-2-(trifluoromethyl)-
- N,N-dimethyl-9-(4-methylbenzyl)-2-(trifluoromethyl)-9H-purin-6-amine
- 6-(Dimethylamino)-9-(4-methylbenzyl)-2-(trifluoromethyl)-9H-purine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.