CAS 117860-54-5
:3-Amino-1-methyl-1H-pyrazole-5-carboxylic acid
Description:
3-Amino-1-methyl-1H-pyrazole-5-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which features an amino group and a carboxylic acid functional group. This compound is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid and amino groups, which can engage in hydrogen bonding. It has a molecular formula that reflects its composition of carbon, hydrogen, nitrogen, and oxygen atoms. The presence of the amino group suggests potential basic properties, while the carboxylic acid group imparts acidic characteristics. This compound is of interest in various fields, including medicinal chemistry and agricultural chemistry, due to its potential biological activity and role as an intermediate in the synthesis of other chemical entities. Its reactivity can be influenced by the functional groups present, allowing for various chemical transformations. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C5H7N3O2
InChI:InChI=1S/C5H7N3O2/c1-8-3(5(9)10)2-4(6)7-8/h2H,1H3,(H2,6,7)(H,9,10)
InChI key:InChIKey=UYTYLLQCQDBCDW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(N)=NN1C
Synonyms:- 3-Amino-1-methyl-1H-pyrazole-5-carboxylic acid
- 1H-Pyrazole-5-carboxylic acid, 3-amino-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
