CAS 117861-55-9

3-Methyl-2-buten-1-yl β-D-glucopyranoside

Description:

3-Methyl-2-buten-1-yl β-D-glucopyranoside, with the CAS number 117861-55-9, is a glycoside compound characterized by its structure, which consists of a glucose moiety linked to a 3-methyl-2-buten-1-yl group. This compound is notable for its potential biological activities, including its role in plant metabolism and possible applications in pharmaceuticals and food science. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the β-D-glucopyranoside linkage suggests that it can participate in various chemical reactions, including hydrolysis, which can release the aglycone and glucose. Its solubility in water and organic solvents varies, influenced by the glycosidic bond and the hydrophilic nature of the glucose unit. Additionally, this compound may exhibit antioxidant properties and could be involved in signaling pathways in plants. Overall, 3-Methyl-2-buten-1-yl β-D-glucopyranoside is of interest in both natural product chemistry and potential therapeutic applications.

Formula: C₁₁H₂₀O₆

InChI: InChI=1S/C11H20O6/c1-6(2)3-4-16-11-10(15)9(14)8(13)7(5-12)17-11/h3,7-15H,4-5H2,1-2H3/t7-,8-,9+,10-,11-/m1/s1

InChI key: InChIKey=GQJQCKUJCHMTNF-KAMPLNKDSA-N

SMILES: O(CC=C(C)C)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O

Synonyms:

• 3-Methyl-2-buten-1-yl β-D-glucopyranoside
• β-D-Glucopyranoside, 3-methyl-2-butenyl
• β-D-Glucopyranoside, 3-methyl-2-buten-1-yl

Prenyl glucoside

CAS: 117861-55-9

Prenyl glucoside is a useful organic compound for research related to life sciences. The catalog number is T126275 and the CAS number is 117861-55-9.

Formula: C₁₁H₂₀O₆

Color and Shape: Solid

Molecular weight: 248.275

Ref: TM-T126275