CymitQuimica logo

CAS 1178650-87-7

:

4-Bromo-α-[(4-bromophenyl)methyl]benzenepropanoic acid

Description:
4-Bromo-α-[(4-bromophenyl)methyl]benzenepropanoic acid, identified by its CAS number 1178650-87-7, is a chemical compound characterized by its complex structure, which includes a propanoic acid moiety and multiple bromine substituents on aromatic rings. This compound features a bromine atom at the 4-position of both the benzene ring and the α-position of the propanoic acid, contributing to its unique reactivity and potential applications in organic synthesis. The presence of bromine enhances the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit interesting biological activities due to its structural features, which could be explored in pharmaceutical research. Its solubility, stability, and reactivity will depend on the specific conditions, such as solvent and temperature. As with many brominated compounds, it is essential to handle this substance with care due to potential environmental and health impacts associated with brominated organic compounds.
Formula:C16H14Br2O2
InChI:InChI=1S/C16H14Br2O2/c17-14-5-1-11(2-6-14)9-13(16(19)20)10-12-3-7-15(18)8-4-12/h1-8,13H,9-10H2,(H,19,20)
InChI key:InChIKey=OWFKJEZZFMKCQG-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(Br)C=C1)(CC2=CC=C(Br)C=C2)C(O)=O
Synonyms:
  • 4-Bromo-α-[(4-bromophenyl)methyl]benzenepropanoic acid
  • Benzenepropanoic acid, 4-bromo-α-[(4-bromophenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.