CAS 117872-75-0: fmoc-O-benzyl-L-threonine
Description:Fmoc-O-benzyl-L-threonine is a derivative of the amino acid threonine, characterized by the presence of a fluorenylmethyloxycarbonyl (Fmoc) protecting group and a benzyl group attached to the hydroxyl side chain. This compound is typically used in peptide synthesis, particularly in solid-phase peptide synthesis (SPPS), where the Fmoc group serves as a protective group for the amino functionality, allowing for selective deprotection and coupling reactions. The benzyl group enhances the hydrophobicity of the molecule, which can influence the solubility and stability of the peptide during synthesis. Fmoc-O-benzyl-L-threonine is generally a white to off-white solid and is soluble in organic solvents like dimethylformamide (DMF) and dimethyl sulfoxide (DMSO), but less soluble in water. Its structure allows for the introduction of threonine into peptides while maintaining the integrity of the hydroxyl group until the desired stage of synthesis. As with many chemical substances, proper handling and storage conditions are essential to maintain its stability and reactivity.
Formula:C26H25NO5
InChI:InChI=1/C26H25NO5/c1-17(31-15-18-9-3-2-4-10-18)24(25(28)29)27-26(30)32-16-23-21-13-7-5-11-19(21)20-12-6-8-14-22(20)23/h2-14,17,23-24H,15-16H2,1H3,(H,27,30)(H,28,29)/t17-,24+/m1/s1
- Synonyms:
- Fmoc-Thr(Bzl)-OH
- O-benzyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-threonine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Fmoc-Thr(Bzl)-OH REF: IN-DA0081EFCAS: 117872-75-0 | 95% | 23.00 €~171.00 € | Tue 04 Mar 25 |
![]() | Fmoc-Thr(Bzl)-OH REF: 54-OR1013393CAS: 117872-75-0 | 98%+ | 32.00 €~1,320.00 € | Mon 03 Mar 25 |
![]() | Fmoc-Thr(Bzl)-OH REF: 7W-GM3129CAS: 117872-75-0 | - - - | To inquire | Mon 03 Mar 25 |
![]() | Fmoc-Thr(Bzl)-OH REF: 10-M03394CAS: 117872-75-0 | 97% | 20.00 €~175.00 € | Wed 05 Mar 25 |
![]() | Fmoc-O-benzyl-L-threonine REF: 3D-FF47361CAS: 117872-75-0 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Fmoc-Thr(Bzl)-OH
Ref: IN-DA0081EF
1g | 23.00 € | ||
5g | 29.00 € | ||
10g | 48.00 € | ||
25g | 74.00 € | ||
100g | 171.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Ref: 54-OR1013393
5g | 32.00 € | ||
25g | 88.00 € | ||
100g | 302.00 € | ||
500g | 1,320.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Fmoc-Thr(Bzl)-OH
Ref: 10-M03394
1g | 20.00 € | ||
5g | 27.00 € | ||
25g | 89.00 € | ||
100g | 175.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Fmoc-O-benzyl-L-threonine
Ref: 3D-FF47361
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information |