CAS 117873-72-0

2,6-dibromo-4-methoxypyridine

Description:

2,6-Dibromo-4-methoxypyridine is a heterocyclic organic compound characterized by a pyridine ring substituted at the 2 and 6 positions with bromine atoms and at the 4 position with a methoxy group. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and agrochemicals due to the presence of the bromine substituents, which can enhance biological activity. The methoxy group contributes to the compound's solubility and reactivity. In terms of chemical properties, 2,6-dibromo-4-methoxypyridine exhibits moderate polarity, making it soluble in organic solvents while being less soluble in water. Its structure allows for various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry. Additionally, the presence of halogens like bromine can influence the compound's reactivity and stability, making it a subject of interest in research and development. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.

Formula: C₆H₅Br₂NO

InChI: InChI=1/C6H5Br2NO/c1-10-4-2-5(7)9-6(8)3-4/h2-3H,1H3

SMILES: COc1cc(Br)nc(c1)Br

Synonyms:

• 2,6-Dibrom-4-methoxypyridin
• Pyridine, 2,6-dibromo-4-methoxy-
• T6Nj Be Do1 Fe
• 2,6-Dibromo-4-méthoxypyridine
• 2,6-Dibromo-4-methoxypyridine
• 2,6-Dibromo-4-methoxypyridine 99%

2,6-Dibromo-4-methoxypyridine

CAS: 117873-72-0

Formula: C₆H₅Br₂NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 266.9180

Ref: IN-DA00330Y

2,6-Dibromo-4-methoxypyridine

CAS: 117873-72-0

2,6-Dibromo-4-methoxypyridine

Formula: C₆H₅Br₂NO

Purity: 99%

Color and Shape: lemon crystalline solid

Molecular weight: 266.92g/mol

Ref: 54-OR345215

2,6-Dibromo-4-methoxypyridine

CAS: 117873-72-0

Formula: C₆H₅Br₂NO

Purity: 95%

Color and Shape: Solid, White to yellow or brown solid

Molecular weight: 266.92

Ref: 10-F321417