
CAS 117873-73-1
:2,4-Dibromo-6-methoxypyridine
Description:
2,4-Dibromo-6-methoxypyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of two bromine substituents at the 2 and 4 positions, along with a methoxy group at the 6 position, contributes to its unique chemical properties. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The bromine atoms enhance the compound's reactivity and can influence its solubility and stability. The methoxy group, being an electron-donating group, can affect the electronic properties of the pyridine ring, potentially altering its reactivity in various chemical reactions. As with many halogenated compounds, 2,4-dibromo-6-methoxypyridine may exhibit specific environmental and health considerations, necessitating careful handling and assessment in laboratory and industrial settings.
Formula:C6H5Br2NO
InChI:InChI=1S/C6H5Br2NO/c1-10-6-3-4(7)2-5(8)9-6/h2-3H,1H3
InChI key:InChIKey=ZCZMZEYFBAVQTN-UHFFFAOYSA-N
SMILES:O(C)C1=CC(Br)=CC(Br)=N1
Synonyms:- Pyridine, 2,4-dibromo-6-methoxy-
- 2,4-Dibromo-6-methoxypyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.