CAS 117883-61-1

1,2-Dihydro-1-methyl-3H-pyrazolo[3,4-b]pyrazin-3-one

Description:

1,2-Dihydro-1-methyl-3H-pyrazolo[3,4-b]pyrazin-3-one is a heterocyclic organic compound characterized by its pyrazolo and pyrazin moieties. This compound features a fused bicyclic structure, which contributes to its unique chemical properties. It typically exhibits a solid state at room temperature and is soluble in polar organic solvents. The presence of the methyl group and the carbonyl functionality in the structure can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, compounds of this class may exhibit biological activity, which has led to interest in their pharmacological properties. The compound's molecular structure allows for potential interactions with biological targets, making it a subject of research in medicinal chemistry. Its CAS number, 117883-61-1, serves as a unique identifier for regulatory and safety information. Overall, 1,2-Dihydro-1-methyl-3H-pyrazolo[3,4-b]pyrazin-3-one is notable for its structural complexity and potential applications in various fields of chemistry and pharmacology.

Formula: C₆H₆N₄O

InChI: InChI=1S/C6H6N4O/c1-10-5-4(6(11)9-10)7-2-3-8-5/h2-3H,1H3,(H,9,11)

InChI key: InChIKey=NMQSMSZULGOJHQ-UHFFFAOYSA-N

SMILES: O=C1C=2C(N(C)N1)=NC=CN2

Synonyms:

• NSC 73563
• 1,2-Dihydro-1-methyl-3H-pyrazolo[3,4-b]pyrazin-3-one
• 3H-Pyrazolo[3,4-b]pyrazin-3-one, 1,2-dihydro-1-methyl-
• 1H-Pyrazolo[3,4-b]pyrazin-3-ol, 1-methyl-
• 1-Methyl-1H-pyrazolo[3,4-b]pyrazin-3-ol