CAS 117887-41-9
:1H-Indol-3-ol, 5-bromo-4-chloro-
Description:
1H-Indol-3-ol, 5-bromo-4-chloro- is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a hydroxyl group (-OH) at the 3-position of the indole ring contributes to its potential as a biological active compound. The bromine and chlorine substituents at the 5 and 4 positions, respectively, introduce halogen functionalities that can influence the compound's reactivity and solubility. This compound is typically used in research settings, particularly in medicinal chemistry, due to its potential pharmacological properties. It may exhibit various biological activities, including antimicrobial or anticancer effects, making it of interest for further studies. The molecular structure and substituents can also affect its interactions with biological targets, thus influencing its efficacy and safety profile. As with many halogenated compounds, considerations regarding environmental impact and toxicity are essential in its application and handling.
Formula:C8H5BrClNO
InChI:InChI=1/C8H5BrClNO/c9-4-1-2-5-7(8(4)10)6(12)3-11-5/h1-3,11-12H
Synonyms:- 5-Brom-4-chlor-1H-indol-3-ol
- 5-bromo-4-chloro-1H-indol-3-ol
- 1H-Indol-3-ol, 5-bromo-4-chloro-
- 5-bromo-4-chloro-3-hydroxyindole
- 1H-Indol-3-ol,5-broMo-4-chloro-,N-Boc
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
5-Bromo-4-chloro-1H-indol-3-ol
CAS:<p>5-Bromo-4-chloro-1H-indol-3-ol is an inhibitor of the enzyme phosphodiesterase, which is involved in regulating the production of the second messenger cyclic GMP. It has been shown to have anti-cancer properties by suppressing the expression of suppressor genes that are involved in tumorigenesis. 5-Bromo-4-chloro-1H-indol-3-ol has also been shown to inhibit bacterial DNA gyrase and topoisomerase IV, which are enzymes that maintain the integrity of bacterial DNA, and prevent cancer cells from proliferating. The enzyme phosphodiesterase is inhibited by carbaryl, a chemical that acts as a competitive inhibitor. 5Bromo-4Chloro1HIndol3Ol has a low expression level and can be used as a model organism for investigating the effects of low expression levels on enzyme activity. The optimum temperature for this enzyme is 37°</p>Formula:C8H5BrClNOPurity:Min. 95%Molecular weight:246.49 g/mol
