CAS 117894-12-9
:(2S,3S,4S)-2-(hydroxymethyl)-1-methylpyrrolidine-3,4-diol
Description:
The chemical substance known as (2S,3S,4S)-2-(hydroxymethyl)-1-methylpyrrolidine-3,4-diol, with the CAS number 117894-12-9, is a chiral compound featuring a pyrrolidine ring. This compound is characterized by the presence of multiple hydroxyl groups, which contribute to its hydrophilicity and potential for forming hydrogen bonds. The specific stereochemistry indicated by the (2S,3S,4S) configuration suggests that it has distinct spatial arrangements that can influence its biological activity and interactions. The hydroxymethyl group enhances its solubility in polar solvents, making it suitable for various applications in pharmaceuticals and biochemistry. Additionally, the presence of the methyl group on the nitrogen atom of the pyrrolidine ring may affect its conformational stability and reactivity. Overall, this compound's unique structural features and stereochemistry make it of interest in the study of biologically active molecules and potential therapeutic agents.
Formula:C6H13NO3
InChI:InChI=1/C6H13NO3/c1-7-2-5(9)6(10)4(7)3-8/h4-6,8-10H,2-3H2,1H3/t4-,5-,6-/m0/s1
SMILES:CN1C[C@@H]([C@H]([C@@H]1CO)O)O
Synonyms:- 3,4-Pyrrolidinediol, 2-(hydroxymethyl)-1-methyl-, (2S,3S,4S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(2S, 3S, 4S) -2- (Hydroxymethyl) - 1- methyl- 3, 4- pyrrolidinediol
CAS:Ketoconazole is an anti-infective agent that is used in the treatment of fungal and yeast infections. It has been shown to inhibit the transcriptional activation of many genes, including those encoding for α subunit of RNA polymerase and sequences involved in drug metabolism. Ketoconazole also inhibits the formation of benzimidazole compounds in bacteria, which are used by some bacteria to protect themselves against other antibiotics. The biological function of ketoconazole is not yet fully understood, but it has been shown to have a negative effect on pancreatic function in CD-1 mice.Purity:Min. 95%
