CAS 117896-10-3: bromo-(4-methoxy-3-methyl-phenyl)magnesium

Description:Bromo-(4-methoxy-3-methyl-phenyl)magnesium, with the CAS number 117896-10-3, is an organomagnesium compound, specifically a Grignard reagent. This compound features a phenyl ring substituted with both a methoxy group and a methyl group, which contributes to its reactivity and solubility characteristics. Grignard reagents are known for their strong nucleophilic properties, allowing them to react readily with electrophiles, making them valuable in organic synthesis for forming carbon-carbon bonds. The presence of the bromine atom enhances its reactivity, facilitating the formation of the magnesium halide bond. Typically, Grignard reagents are sensitive to moisture and air, requiring an anhydrous environment for stability. They are often used in the synthesis of alcohols, ketones, and other organic compounds through nucleophilic addition reactions. The specific steric and electronic effects of the methoxy and methyl substituents can influence the reactivity and selectivity of this reagent in various chemical transformations.

Formula:C₈H₉BrMgO

InChI:InChI=1/C8H9O.BrH.Mg/c1-7-5-3-4-6-8(7)9-2;;/h4-6H,1-2H3;1H;/q;;+1/p-1/rC8H9BrMgO/c1-6-5-7(10-9)3-4-8(6)11-2/h3-5H,1-2H3