CAS 1179-29-9
:1-(2,4-dinitrophenyl)-2-{(3Z)-3-[2-(2,4-dinitrophenyl)hydrazinylidene]butan-2-ylidene}hydrazine
Description:
1-(2,4-Dinitrophenyl)-2-{(3Z)-3-[2-(2,4-dinitrophenyl)hydrazinylidene]butan-2-ylidene}hydrazine, with CAS number 1179-29-9, is a complex organic compound characterized by its hydrazine functional groups and dinitrophenyl substituents. This substance typically exhibits a yellow to orange color due to the presence of dinitrophenyl groups, which are known for their strong electron-withdrawing properties. The compound is likely to be a solid at room temperature and may have a relatively high melting point. Its structure suggests potential applications in organic synthesis, particularly in the development of azo dyes or as intermediates in pharmaceuticals. However, due to the presence of dinitro groups, it may also exhibit explosive properties under certain conditions, necessitating careful handling and storage. Additionally, the compound may be sensitive to light and moisture, which could affect its stability. As with many hydrazine derivatives, it may pose health risks, including toxicity and potential carcinogenicity, thus requiring appropriate safety measures during use.
Formula:C16H14N8O8
InChI:InChI=1/C16H14N8O8/c1-9(17-19-13-5-3-11(21(25)26)7-15(13)23(29)30)10(2)18-20-14-6-4-12(22(27)28)8-16(14)24(31)32/h3-8,19-20H,1-2H3/b17-9-,18-10u
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Diacetyl Bis(2,4-dinitrophenylhydrazone)
CAS:Controlled Product<p>Applications 2,4-Dinitrophenylhydrazone (DNPH) derivative.<br>References Lindsay, R.C., et al.: J. Food Sci., 29, 266 (1964),<br></p>Formula:C16H14N8O8Color and Shape:NeatMolecular weight:446.33
