CAS 117903-53-4
:MESO-1,2-BIS(4-BROMOPHENYL)ETHANEDIAMINE
Description:
MESO-1,2-BIS(4-BROMOPHENYL)ETHANEDIAMINE is an organic compound characterized by its unique structure, which includes two 4-bromophenyl groups attached to a central ethanediamine backbone. This compound is classified as a diamine due to the presence of two amine functional groups (-NH2) that can participate in various chemical reactions, including those involving nucleophilic substitution and coordination with metal ions. The presence of bromine substituents enhances its reactivity and can influence its solubility and interaction with other molecules. MESO-1,2-BIS(4-BROMOPHENYL)ETHANEDIAMINE is often studied in the context of organic synthesis and materials science, particularly for its potential applications in pharmaceuticals and as a ligand in coordination chemistry. Its meso configuration indicates that it possesses an internal plane of symmetry, which can affect its optical properties and reactivity. Overall, this compound is of interest for its structural features and potential applications in various chemical fields.
Formula:C14H16Br2N2
InChI:InChI=1/C14H14Br2N2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10/h1-8,13-14H,17-18H2/p+2/t13-,14+
Synonyms:- 1,2-Bis(4-Bromophenyl)Ethane-1,2-Diamine
- Meso-1,2-Bis(4-Bromophenyl)Ethanediamine, 98+%
- (1R,2S)-1,2-bis(4-bromophenyl)ethane-1,2-diaminium
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.