
CAS 1179072-78-6
:2-Amino-N-[(8-methyl-8-azabicyclo[3.2.1]oct-3-yl)methyl]acetamide
Description:
2-Amino-N-[(8-methyl-8-azabicyclo[3.2.1]oct-3-yl)methyl]acetamide, identified by its CAS number 1179072-78-6, is a chemical compound characterized by its unique bicyclic structure, which includes a nitrogen atom in the ring, contributing to its potential biological activity. This compound features an amino group and an acetamide functional group, which may enhance its solubility and reactivity. The presence of the 8-methyl-8-azabicyclo[3.2.1]octane moiety suggests that it may interact with biological systems, possibly as a ligand for receptors or enzymes. The bicyclic structure can also influence its conformational flexibility and steric properties, which are critical for its interaction with biological targets. Additionally, the compound's molecular weight, polarity, and potential for hydrogen bonding are important factors that can affect its pharmacokinetics and pharmacodynamics. Overall, this compound's structural features indicate potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or other biological pathways.
Formula:C11H21N3O
InChI:InChI=1S/C11H21N3O/c1-14-9-2-3-10(14)5-8(4-9)7-13-11(15)6-12/h8-10H,2-7,12H2,1H3,(H,13,15)
InChI key:InChIKey=UQAPMMIRQVUUDN-UHFFFAOYSA-N
SMILES:CN1C2CC(CNC(CN)=O)CC1CC2
Synonyms:- Acetamide, 2-amino-N-[(8-methyl-8-azabicyclo[3.2.1]oct-3-yl)methyl]-
- 2-Amino-N-[(8-methyl-8-azabicyclo[3.2.1]oct-3-yl)methyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.