CAS 1179148-81-2
:6-Methoxy-1-isoquinolinecarboxylic acid
Description:
6-Methoxy-1-isoquinolinecarboxylic acid is a chemical compound characterized by its isoquinoline structure, which features a methoxy group (-OCH3) at the 6-position and a carboxylic acid group (-COOH) at the 1-position. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, including potential acidity due to the carboxylic group and the ability to participate in hydrogen bonding. Its methoxy substituent can influence its solubility and reactivity, often enhancing lipophilicity. The presence of the isoquinoline moiety suggests potential biological activity, as many isoquinoline derivatives are known for their pharmacological properties. The compound may be utilized in various applications, including medicinal chemistry, where it could serve as a scaffold for drug development or as a research tool in studying biological pathways. Additionally, its unique structure may allow for further derivatization, leading to a range of potential derivatives with varied properties and activities.
Formula:C11H9NO3
InChI:InChI=1S/C11H9NO3/c1-15-8-2-3-9-7(6-8)4-5-12-10(9)11(13)14/h2-6H,1H3,(H,13,14)
InChI key:InChIKey=HKWKVZRIFSAVLQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(C=C(OC)C=C2)C=CN1
Synonyms:- 1-Isoquinolinecarboxylic acid, 6-methoxy-
- 6-Methoxy-1-isoquinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
