
CAS 117918-26-0
:Methyl 1-benzoyl-3-bromo-1H-pyrrole-2-carboxylate
Description:
Methyl 1-benzoyl-3-bromo-1H-pyrrole-2-carboxylate, identified by its CAS number 117918-26-0, is a chemical compound that features a pyrrole ring, which is a five-membered aromatic heterocycle containing nitrogen. This compound is characterized by the presence of a benzoyl group and a bromo substituent, which contribute to its reactivity and potential applications in organic synthesis. The methyl ester functional group enhances its solubility in organic solvents and may influence its biological activity. Methyl 1-benzoyl-3-bromo-1H-pyrrole-2-carboxylate is of interest in medicinal chemistry and materials science due to its structural features, which may allow for the development of novel pharmaceuticals or agrochemicals. Its synthesis typically involves multi-step reactions, and it may exhibit specific properties such as fluorescence or unique reactivity patterns, making it a valuable compound for research and development in various chemical fields. As with many organic compounds, safety precautions should be observed when handling this substance due to potential hazards associated with its chemical structure.
Formula:C13H10BrNO3
InChI:InChI=1S/C13H10BrNO3/c1-18-13(17)11-10(14)7-8-15(11)12(16)9-5-3-2-4-6-9/h2-8H,1H3
InChI key:InChIKey=VOTUXZVZNHKSBW-UHFFFAOYSA-N
SMILES:C(=O)(N1C(C(OC)=O)=C(Br)C=C1)C2=CC=CC=C2
Synonyms:- 1H-Pyrrole-2-carboxylic acid, 1-benzoyl-3-bromo-, methyl ester
- Methyl 1-benzoyl-3-bromo-1H-pyrrole-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
