
CAS 117923-35-0
:1-Hexyl-4-[(4-methylphenyl)ethynyl]benzene
Description:
1-Hexyl-4-[(4-methylphenyl)ethynyl]benzene, with the CAS number 117923-35-0, is an organic compound characterized by its extended conjugated system, which contributes to its potential applications in organic electronics and materials science. This compound features a hexyl chain that enhances its solubility in organic solvents, making it suitable for various chemical processes. The presence of the ethynyl group introduces a triple bond, which can facilitate unique reactivity and interactions with other molecules. Additionally, the para-substituted methylphenyl group provides steric and electronic effects that can influence the compound's optical and electronic properties. Typically, compounds of this nature exhibit interesting photophysical characteristics, such as fluorescence or phosphorescence, which are valuable in the development of light-emitting devices. Its structural features suggest potential utility in organic light-emitting diodes (OLEDs) and other optoelectronic applications. However, specific properties such as melting point, boiling point, and solubility would need to be referenced from experimental data for precise applications.
Formula:C21H24
InChI:InChI=1S/C21H24/c1-3-4-5-6-7-19-12-14-21(15-13-19)17-16-20-10-8-18(2)9-11-20/h8-15H,3-7H2,1-2H3
InChI key:InChIKey=XYAMCKXIFIIWHA-UHFFFAOYSA-N
SMILES:C(#CC1=CC=C(C)C=C1)C2=CC=C(CCCCCC)C=C2
Synonyms:- Benzene, 1-hexyl-4-[(4-methylphenyl)ethynyl]-
- 1-Hexyl-4-[(4-methylphenyl)ethynyl]benzene
- 1-n-Hexyl-4-[(p-tolyl)ethynyl]benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
