CymitQuimica logo

CAS 1179337-15-5

:

1,1-Dimethylethyl 2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate

Description:
1,1-Dimethylethyl 2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate, identified by its CAS number 1179337-15-5, is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen heteroatoms. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility in various solvents. The presence of difluoro substituents suggests enhanced lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The dimethyl group attached to the nitrogen enhances steric hindrance, which can affect the compound's conformation and interactions with biological targets. Additionally, the spirocyclic framework may impart rigidity, potentially influencing the compound's pharmacokinetic properties. Overall, this substance may exhibit unique chemical behavior and biological activity, warranting further investigation for applications in pharmaceuticals or agrochemicals. However, specific properties such as melting point, boiling point, and solubility would require empirical data for a comprehensive understanding.
Formula:C13H22F2N2O3
InChI:InChI=1S/C13H22F2N2O3/c1-11(2,3)19-10(18)17-6-4-12(5-7-17)8-16-9-13(14,15)20-12/h16H,4-9H2,1-3H3
InChI key:InChIKey=QFFLDEOZINEKMT-UHFFFAOYSA-N
SMILES:FC1(F)OC2(CCN(C(OC(C)(C)C)=O)CC2)CNC1
Synonyms:
  • 1-Oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid, 2,2-difluoro-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.