CAS 1179359-56-8

N-(5-Iodo-3-nitro-2-pyridinyl)glycine methyl ester

Description:

N-(5-Iodo-3-nitro-2-pyridinyl)glycine methyl ester is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with both an iodine and a nitro group, along with a glycine moiety esterified with a methyl group. This compound typically exhibits properties associated with both the pyridine and amino acid functionalities, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the amino and carboxyl groups. The iodine substituent may impart specific reactivity, while the nitro group can influence electronic properties, making it a candidate for various chemical reactions. Additionally, the methyl ester form suggests that it may be more lipophilic compared to its free acid counterpart, potentially affecting its biological activity and pharmacokinetics. Overall, this compound may be of interest in medicinal chemistry and research applications, particularly in the development of pharmaceuticals or as a biochemical probe.

Formula: C₈H₈IN₃O₄

InChI: InChI=1S/C8H8IN3O4/c1-16-7(13)4-11-8-6(12(14)15)2-5(9)3-10-8/h2-3H,4H2,1H3,(H,10,11)

InChI key: InChIKey=HRTMVBFPPNSZHW-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(NCC(OC)=O)N=CC(I)=C1

Synonyms:

• N-(5-Iodo-3-nitro-2-pyridinyl)glycine methyl ester
• Glycine, N-(5-iodo-3-nitro-2-pyridinyl)-, methyl ester