CAS 1179359-63-7

Benzyl 3-(methylamino)-1-piperidinecarboxylate hydrochloride (1:1)

Description:

Benzyl 3-(methylamino)-1-piperidinecarboxylate hydrochloride (1:1) is a chemical compound characterized by its piperidine structure, which includes a benzyl group and a methylamino substituent. This compound is typically a white to off-white crystalline solid, soluble in water and various organic solvents, which is indicative of its hydrochloride salt form. The presence of the piperidine ring contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The hydrochloride salt enhances its stability and solubility, facilitating its use in various applications. Its molecular structure suggests potential interactions with biological targets, which may lead to effects on neurotransmitter systems. As with many piperidine derivatives, it may exhibit properties such as analgesic or psychoactive effects, although specific biological activities would depend on further empirical studies. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₄H₂₁ClN₂O₂

InChI: InChI=1S/C14H20N2O2.ClH/c1-15-13-8-5-9-16(10-13)14(17)18-11-12-6-3-2-4-7-12;/h2-4,6-7,13,15H,5,8-11H2,1H3;1H

SMILES: CNC1CCCN(C1)C(=O)OCc1ccccc1.Cl

Synonyms:

• 1-Piperidinecarboxylic acid, 3-hydroxy-, phenylmethyl ester, (S)-

Benzyl 3-(methylamino)piperidine-1-carboxylate hydrochloride

CAS: 1179359-63-7

Formula: C₁₄H₂₁ClN₂O₂

Molecular weight: 284.7817

Ref: IN-DA008Y8V