
CAS 1179359-70-6
:2-Quinolinecarboximidamide, 8-fluoro-, hydrochloride (1:1)
Description:
2-Quinolinecarboximidamide, 8-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. The presence of a carboximidamide functional group indicates that it has both an amine and an imine, contributing to its potential biological activity. The "8-fluoro" designation suggests that a fluorine atom is substituted at the 8-position of the quinoline ring, which can influence the compound's reactivity and pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for pharmaceutical applications. This compound may exhibit various biological activities, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific interactions, stability, and efficacy would depend on its molecular structure and the presence of functional groups, which can affect its behavior in biological systems. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.
Formula:C10H8FN3·ClH
InChI:InChI=1S/C10H8FN3.ClH/c11-7-3-1-2-6-4-5-8(10(12)13)14-9(6)7;/h1-5H,(H3,12,13);1H
InChI key:InChIKey=MOYXPFJKAPAOTR-UHFFFAOYSA-N
SMILES:FC=1C2=C(C=CC(C(=N)N)=N2)C=CC1.Cl
Synonyms:- 2-Quinolinecarboximidamide, 8-fluoro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
