CymitQuimica logo

CAS 1179359-71-7

:

3-(3-Bromo-2-pyridinyl)-1,2,4-thiadiazol-5-amine

Description:
3-(3-Bromo-2-pyridinyl)-1,2,4-thiadiazol-5-amine is a chemical compound characterized by its unique structural features, which include a thiadiazole ring and a pyridine moiety. The presence of a bromine atom at the 3-position of the pyridine ring contributes to its reactivity and potential applications in various chemical reactions. This compound is typically classified as a heterocyclic organic compound, which often exhibits biological activity, making it of interest in medicinal chemistry and drug development. The thiadiazole ring is known for its diverse pharmacological properties, including antimicrobial and anti-inflammatory effects. Additionally, the amine functional group enhances its solubility and reactivity, allowing for further derivatization. The compound's molecular structure suggests potential interactions with biological targets, which could be explored in research settings. Overall, 3-(3-Bromo-2-pyridinyl)-1,2,4-thiadiazol-5-amine represents a valuable scaffold for the synthesis of novel therapeutic agents.
Formula:C7H5BrN4S
InChI:InChI=1S/C7H5BrN4S/c8-4-2-1-3-10-5(4)6-11-7(9)13-12-6/h1-3H,(H2,9,11,12)
InChI key:InChIKey=NEVLVFVXHGVMCT-UHFFFAOYSA-N
SMILES:BrC1=C(N=CC=C1)C=2N=C(N)SN2
Synonyms:
  • 3-(3-Bromo-2-pyridinyl)-1,2,4-thiadiazol-5-amine
  • 1,2,4-Thiadiazol-5-amine, 3-(3-bromo-2-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.