CAS 1179360-29-2

3-(1,8-Naphthyridin-2-yl)-1,2,4-thiadiazol-5-amine

Description:

3-(1,8-Naphthyridin-2-yl)-1,2,4-thiadiazol-5-amine is a chemical compound characterized by its unique structural features, which include a naphthyridine moiety and a thiadiazole ring. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in various organic solvents. The presence of the thiadiazole ring suggests it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the naphthyridine component may contribute to its electronic properties, potentially influencing its reactivity and interaction with biological targets. Compounds of this nature are often investigated for their pharmacological properties, including antimicrobial, anti-inflammatory, or anticancer activities. The specific characteristics, such as melting point, boiling point, and spectral data (NMR, IR, etc.), would depend on the compound's purity and the conditions under which it is analyzed. Overall, this compound represents a class of heterocycles that are of interest in medicinal chemistry and materials science.

Formula: C₁₀H₇N₅S

InChI: InChI=1S/C10H7N5S/c11-10-14-9(15-16-10)7-4-3-6-2-1-5-12-8(6)13-7/h1-5H,(H2,11,14,15)

InChI key: InChIKey=CTEKJEXXHXHQCA-UHFFFAOYSA-N

SMILES: NC1=NC(C2=NC3=C(C=C2)C=CC=N3)=NS1

Synonyms:

• 3-(1,8-Naphthyridin-2-yl)-1,2,4-thiadiazol-5-amine
• 1,2,4-Thiadiazol-5-amine, 3-(1,8-naphthyridin-2-yl)-