
CAS 1179360-52-1
:2-Pyridinecarboximidamide, 4-ethoxy-, hydrochloride (1:1)
Description:
2-Pyridinecarboximidamide, 4-ethoxy-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboximidamide functional group, which is indicative of its potential as a biological or pharmaceutical agent. The presence of the ethoxy group enhances its solubility and may influence its reactivity and interaction with biological systems. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, including in medicinal chemistry. The compound's molecular structure suggests potential uses in drug development, particularly in targeting specific biological pathways. Its properties, such as melting point, solubility, and reactivity, would be influenced by the functional groups present and the overall molecular architecture. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings. Further studies would be necessary to fully elucidate its biological activity and potential applications.
Formula:C8H11N3O·ClH
InChI:InChI=1S/C8H11N3O.ClH/c1-2-12-6-3-4-11-7(5-6)8(9)10;/h3-5H,2H2,1H3,(H3,9,10);1H
InChI key:InChIKey=ZSXSZBWGVDVYPF-UHFFFAOYSA-N
SMILES:O(CC)C=1C=C(C(=N)N)N=CC1.Cl
Synonyms:- 2-Pyridinecarboximidamide, 4-ethoxy-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
